C13H24O11P2 — CID 131972712
[6-[3-(2-methylprop-2-enoyloxy)propanoyloxy]-1-phosphonooxyhexyl]phosphonic acid (PubChem CID 131972712) has the molecular formula C13H24O11P2 and a molecular weight of 418.27 g/mol. Its IUPAC name is [6-[3-(2-methylprop-2-enoyloxy)propanoyloxy]-1-phosphonooxyhexyl]phosphonic acid.
| Compound Name | [6-[3-(2-methylprop-2-enoyloxy)propanoyloxy]-1-phosphonooxyhexyl]phosphonic acid |
|---|---|
| PubChem CID | 131972712 |
| Molecular Formula | C13H24O11P2 |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [6-[3-(2-methylprop-2-enoyloxy)propanoyloxy]-1-phosphonooxyhexyl]phosphonic acid |
| SMILES | C=C(C)C(=O)OCCC(=O)OCCCCCC(OP(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C13H24O11P2/c1-10(2)13(15)23-9-7-11(14)22-8-5-3-4-6-12(25(16,17)18)24-26(19,20)21/h12H,1,3-9H2,2H3,(H2,16,17,18)(H2,19,20,21) |
| InChIKey | HHLJVRAHHURHBY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|