C17H32N2O10P2 — CID 131972714
[6-[1,3-bis(2-methylprop-2-enoylamino)propan-2-yloxy]-1-phosphonooxyhexyl]phosphonic acid (PubChem CID 131972714) has the molecular formula C17H32N2O10P2 and a molecular weight of 486.40 g/mol. Its IUPAC name is [6-[1,3-bis(2-methylprop-2-enoylamino)propan-2-yloxy]-1-phosphonooxyhexyl]phosphonic acid.
| Compound Name | [6-[1,3-bis(2-methylprop-2-enoylamino)propan-2-yloxy]-1-phosphonooxyhexyl]phosphonic acid |
|---|---|
| PubChem CID | 131972714 |
| Molecular Formula | C17H32N2O10P2 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | [6-[1,3-bis(2-methylprop-2-enoylamino)propan-2-yloxy]-1-phosphonooxyhexyl]phosphonic acid |
| SMILES | C=C(C)C(=O)NCC(CNC(=O)C(=C)C)OCCCCCC(OP(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C17H32N2O10P2/c1-12(2)16(20)18-10-14(11-19-17(21)13(3)4)28-9-7-5-6-8-15(30(22,23)24)29-31(25,26)27/h14-15H,1,3,5-11H2,2,4H3,(H,18,20)(H,19,21)(H2,22,23,24)(H2,25,26,27) |
| InChIKey | VVSSWJAVJHDEBX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 191.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|