C19H18N2O3S — CID 130473907
5-methoxy-9-(4-methylphenyl)sulfonyl-3,4-dihydropyrido[3,4-b]indole (PubChem CID 130473907) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is 5-methoxy-9-(4-methylphenyl)sulfonyl-3,4-dihydropyrido[3,4-b]indole.
| Compound Name | 5-methoxy-9-(4-methylphenyl)sulfonyl-3,4-dihydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 130473907 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 5-methoxy-9-(4-methylphenyl)sulfonyl-3,4-dihydropyrido[3,4-b]indole |
| SMILES | COc1cccc2c1c1c(n2S(=O)(=O)c2ccc(C)cc2)C=NCC1 |
| InChI | InChI=1S/C19H18N2O3S/c1-13-6-8-14(9-7-13)25(22,23)21-16-4-3-5-18(24-2)19(16)15-10-11-20-12-17(15)21/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | LUVSIPABYBLQON-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |