C27H32N2O3S — CID 158189391
(3S,12bS)-3-ethyl-2-ethylidene-8-methoxy-12-(4-methylphenyl)sulfonyl-1,3,4,6,7,12b-hexahydroindolo[2,3-a]quinolizine (PubChem CID 158189391) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is (3S,12bS)-3-ethyl-2-ethylidene-8-methoxy-12-(4-methylphenyl)sulfonyl-1,3,4,6,7,12b-hexahydroindolo[2,3-a]quinolizine.
| Compound Name | (3S,12bS)-3-ethyl-2-ethylidene-8-methoxy-12-(4-methylphenyl)sulfonyl-1,3,4,6,7,12b-hexahydroindolo[2,3-a]quinolizine |
|---|---|
| PubChem CID | 158189391 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | (3S,12bS)-3-ethyl-2-ethylidene-8-methoxy-12-(4-methylphenyl)sulfonyl-1,3,4,6,7,12b-hexahydroindolo[2,3-a]quinolizine |
| SMILES | CC=C1C[C@H]2c3c(c4c(OC)cccc4n3S(=O)(=O)c3ccc(C)cc3)CCN2C[C@H]1CC |
| InChI | InChI=1S/C27H32N2O3S/c1-5-19-16-24-27-22(14-15-28(24)17-20(19)6-2)26-23(8-7-9-25(26)32-4)29(27)33(30,31)21-12-10-18(3)11-13-21/h5,7-13,20,24H,6,14-17H2,1-4H3/t20-,24+/m1/s1 |
| InChIKey | MXQINWFJNJCXFY-YKSBVNFPSA-N |
| XLogP | 5.47 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|