C31H25N5O5S — CID 130475256
7-[4-(1-benzofuran-7-yloxy)-2-methylphenyl]-6-oxo-N-(1-prop-2-enoylpyrrolidin-3-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 130475256) has the molecular formula C31H25N5O5S and a molecular weight of 579.64 g/mol. Its IUPAC name is 7-[4-(1-benzofuran-7-yloxy)-2-methylphenyl]-6-oxo-N-(1-prop-2-enoylpyrrolidin-3-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-[4-(1-benzofuran-7-yloxy)-2-methylphenyl]-6-oxo-N-(1-prop-2-enoylpyrrolidin-3-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 130475256 |
| Molecular Formula | C31H25N5O5S |
| Molecular Weight | 579.64 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | 7-[4-(1-benzofuran-7-yloxy)-2-methylphenyl]-6-oxo-N-(1-prop-2-enoylpyrrolidin-3-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N1CCC(NC(=O)c2sc3nccc4c3c2NC(=O)N4c2ccc(Oc3cccc4ccoc34)cc2C)C1 |
| InChI | InChI=1S/C31H25N5O5S/c1-3-24(37)35-13-10-19(16-35)33-29(38)28-26-25-22(9-12-32-30(25)42-28)36(31(39)34-26)21-8-7-20(15-17(21)2)41-23-6-4-5-18-11-14-40-27(18)23/h3-9,11-12,14-15,19H,1,10,13,16H2,2H3,(H,33,38)(H,34,39) |
| InChIKey | KVFZMKYKBDPAIR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.64 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|