C19H32O6 — CID 130476492
(3aR,4R,5R,6R,7R,7aS)-5,6-dicyclohexyloxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,7-diol (PubChem CID 130476492) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is (3aR,4R,5R,6R,7R,7aS)-5,6-dicyclohexyloxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,7-diol.
| Compound Name | (3aR,4R,5R,6R,7R,7aS)-5,6-dicyclohexyloxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,7-diol |
|---|---|
| PubChem CID | 130476492 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (3aR,4R,5R,6R,7R,7aS)-5,6-dicyclohexyloxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,7-diol |
| SMILES | O[C@@H]1[C@@H](OC2CCCCC2)[C@H](OC2CCCCC2)[C@@H](O)[C@@H]2OCO[C@H]12 |
| InChI | InChI=1S/C19H32O6/c20-14-16-17(23-11-22-16)15(21)19(25-13-9-5-2-6-10-13)18(14)24-12-7-3-1-4-8-12/h12-21H,1-11H2/t14-,15-,16-,17+,18+,19+/m0/s1 |
| InChIKey | ZRCZWQOACJWGJD-LOXVXLSQSA-N |
| XLogP | 1.90 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |