C8H11NO4 — CID 130761651
2-[(3aS,4S,5S,6R,6aR)-4,5-dihydroxy-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]acetonitrile (PubChem CID 130761651) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-[(3aS,4S,5S,6R,6aR)-4,5-dihydroxy-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]acetonitrile.
| Compound Name | 2-[(3aS,4S,5S,6R,6aR)-4,5-dihydroxy-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]acetonitrile |
|---|---|
| PubChem CID | 130761651 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2-[(3aS,4S,5S,6R,6aR)-4,5-dihydroxy-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]acetonitrile |
| SMILES | N#CC[C@@H]1[C@H](O)[C@H](O)[C@@H]2OCO[C@H]12 |
| InChI | InChI=1S/C8H11NO4/c9-2-1-4-5(10)6(11)8-7(4)12-3-13-8/h4-8,10-11H,1,3H2/t4-,5+,6+,7-,8+/m1/s1 |
| InChIKey | MFRNCBFXDJMEHO-HNEXDWKRSA-N |
| XLogP | -1.01 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |