About 1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine
1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine (PubChem CID 130479120) has the molecular formula C10H18N4
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine |
| PubChem CID | 130479120 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(CCC2CCCCC2)n1 |
| InChI | InChI=1S/C10H18N4/c11-10-12-8-14(13-10)7-6-9-4-2-1-3-5-9/h8-9H,1-7H2,(H2,11,13) |
| InChIKey | NHMCQTRFEWLEHF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine?
The IUPAC name of 1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine (CID 130479120) is 1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine?
The canonical SMILES for 1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine is Nc1ncn(CCC2CCCCC2)n1.
What is the InChIKey of 1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine?
The InChIKey is NHMCQTRFEWLEHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4/c11-10-12-8-14(13-10)7-6-9-4-2-1-3-5-9/h8-9H,1-7H2,(H2,11,13).
What are the key properties of 1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine?
1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine has a molecular weight of 194.28 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclohexylethyl)-1,2,4-triazol-3-amine is sourced from PubChem (CID 130479120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).