C8H14N4O2S — CID 165482828
1-[2-(1,1-dioxothiolan-3-yl)ethyl]-1,2,4-triazol-3-amine (PubChem CID 165482828) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 1-[2-(1,1-dioxothiolan-3-yl)ethyl]-1,2,4-triazol-3-amine.
| Compound Name | 1-[2-(1,1-dioxothiolan-3-yl)ethyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 165482828 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-[2-(1,1-dioxothiolan-3-yl)ethyl]-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(CCC2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C8H14N4O2S/c9-8-10-6-12(11-8)3-1-7-2-4-15(13,14)5-7/h6-7H,1-5H2,(H2,9,11) |
| InChIKey | XACPCMWMMKDRKJ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |