C9H12F2N2O — CID 130487700
1-[(3,3-difluorocyclopentyl)methyl]pyrazol-4-ol (PubChem CID 130487700) has the molecular formula C9H12F2N2O and a molecular weight of 202.20 g/mol. Its IUPAC name is 1-[(3,3-difluorocyclopentyl)methyl]pyrazol-4-ol.
| Compound Name | 1-[(3,3-difluorocyclopentyl)methyl]pyrazol-4-ol |
|---|---|
| PubChem CID | 130487700 |
| Molecular Formula | C9H12F2N2O |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 1-[(3,3-difluorocyclopentyl)methyl]pyrazol-4-ol |
| SMILES | Oc1cnn(CC2CCC(F)(F)C2)c1 |
| InChI | InChI=1S/C9H12F2N2O/c10-9(11)2-1-7(3-9)5-13-6-8(14)4-12-13/h4,6-7,14H,1-3,5H2 |
| InChIKey | ACDPMJIVBQZCSI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |