About 1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene
1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene (PubChem CID 130489186) has the molecular formula C14H19Cl
and a molecular weight of 222.76 g/mol. Its IUPAC name is 1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene.
Molecular Properties
| Compound Name | 1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene |
| PubChem CID | 130489186 |
| Molecular Formula | C14H19Cl |
| Molecular Weight | 222.76 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene |
| SMILES | CCc1ccc(C2C(CCl)C2(C)C)cc1 |
| InChI | InChI=1S/C14H19Cl/c1-4-10-5-7-11(8-6-10)13-12(9-15)14(13,2)3/h5-8,12-13H,4,9H2,1-3H3 |
| InChIKey | RPOGRHNQRIHAIB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.76 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene?
The IUPAC name of 1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene (CID 130489186) is 1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene.
What is the SMILES notation for 1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene?
The canonical SMILES for 1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene is CCc1ccc(C2C(CCl)C2(C)C)cc1.
What is the InChIKey of 1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene?
The InChIKey is RPOGRHNQRIHAIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19Cl/c1-4-10-5-7-11(8-6-10)13-12(9-15)14(13,2)3/h5-8,12-13H,4,9H2,1-3H3.
What are the key properties of 1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene?
1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene has a molecular weight of 222.76 g/mol, XLogP of 4.23, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(chloromethyl)-2,2-dimethylcyclopropyl]-4-ethylbenzene is sourced from PubChem (CID 130489186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).