C8H10N4OS — CID 130497445
4-(5-methoxy-1-methylpyrazol-3-yl)-1,3-thiazol-2-amine (PubChem CID 130497445) has the molecular formula C8H10N4OS and a molecular weight of 210.26 g/mol. Its IUPAC name is 4-(5-methoxy-1-methylpyrazol-3-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(5-methoxy-1-methylpyrazol-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130497445 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 4-(5-methoxy-1-methylpyrazol-3-yl)-1,3-thiazol-2-amine |
| SMILES | COc1cc(-c2csc(N)n2)nn1C |
| InChI | InChI=1S/C8H10N4OS/c1-12-7(13-2)3-5(11-12)6-4-14-8(9)10-6/h3-4H,1-2H3,(H2,9,10) |
| InChIKey | YTTXBLQBJBKCBR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |