C9H8ClFO2 — CID 130501634
(4R)-8-chloro-5-fluoro-3,4-dihydro-2H-chromen-4-ol (PubChem CID 130501634) has the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. Its IUPAC name is (4R)-8-chloro-5-fluoro-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4R)-8-chloro-5-fluoro-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 130501634 |
| Molecular Formula | C9H8ClFO2 |
| Molecular Weight | 202.61 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | (4R)-8-chloro-5-fluoro-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@@H]1CCOc2c(Cl)ccc(F)c21 |
| InChI | InChI=1S/C9H8ClFO2/c10-5-1-2-6(11)8-7(12)3-4-13-9(5)8/h1-2,7,12H,3-4H2/t7-/m1/s1 |
| InChIKey | ZOJJHNQSOCPWSZ-SSDOTTSWSA-N |
| XLogP | 2.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.61 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |