C9H9FO2 — CID 102990724
4-fluoro-7-methyl-2,3-dihydro-1-benzofuran-3-ol (PubChem CID 102990724) has the molecular formula C9H9FO2 and a molecular weight of 168.17 g/mol. Its IUPAC name is 4-fluoro-7-methyl-2,3-dihydro-1-benzofuran-3-ol.
| Compound Name | 4-fluoro-7-methyl-2,3-dihydro-1-benzofuran-3-ol |
|---|---|
| PubChem CID | 102990724 |
| Molecular Formula | C9H9FO2 |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 4-fluoro-7-methyl-2,3-dihydro-1-benzofuran-3-ol |
| SMILES | Cc1ccc(F)c2c1OCC2O |
| InChI | InChI=1S/C9H9FO2/c1-5-2-3-6(10)8-7(11)4-12-9(5)8/h2-3,7,11H,4H2,1H3 |
| InChIKey | DDLSBAFKUDBFSN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |