About 8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride
8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride (PubChem CID 127263941) has the molecular formula C9H7Cl2FO2
and a molecular weight of 237.06 g/mol. Its IUPAC name is 8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride.
Molecular Properties
| Compound Name | 8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride |
| PubChem CID | 127263941 |
| Molecular Formula | C9H7Cl2FO2 |
| Molecular Weight | 237.06 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride |
| SMILES | Cl.O=C1CCOc2c(Cl)ccc(F)c21 |
| InChI | InChI=1S/C9H6ClFO2.ClH/c10-5-1-2-6(11)8-7(12)3-4-13-9(5)8;/h1-2H,3-4H2;1H |
| InChIKey | RFUJXGHWUSEIRG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.06 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride?
The IUPAC name of 8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride (CID 127263941) is 8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride.
What is the SMILES notation for 8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride?
The canonical SMILES for 8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride is Cl.O=C1CCOc2c(Cl)ccc(F)c21.
What is the InChIKey of 8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride?
The InChIKey is RFUJXGHWUSEIRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClFO2.ClH/c10-5-1-2-6(11)8-7(12)3-4-13-9(5)8;/h1-2H,3-4H2;1H.
What are the key properties of 8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride?
8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride has a molecular weight of 237.06 g/mol, XLogP of 2.87, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-5-fluoro-2,3-dihydrochromen-4-one;hydrochloride is sourced from PubChem (CID 127263941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).