C10H19NO2 — CID 130517363
5-(2,4-dimethylpentan-3-yl)-1,3-oxazolidin-2-one (PubChem CID 130517363) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 5-(2,4-dimethylpentan-3-yl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(2,4-dimethylpentan-3-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 130517363 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 5-(2,4-dimethylpentan-3-yl)-1,3-oxazolidin-2-one |
| SMILES | CC(C)C(C(C)C)C1CNC(=O)O1 |
| InChI | InChI=1S/C10H19NO2/c1-6(2)9(7(3)4)8-5-11-10(12)13-8/h6-9H,5H2,1-4H3,(H,11,12) |
| InChIKey | ITDKERSNEBCFBB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |