About N,N-diethyl-5,6-dimethylpiperidin-3-amine
N,N-diethyl-5,6-dimethylpiperidin-3-amine (PubChem CID 130560219) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is N,N-diethyl-5,6-dimethylpiperidin-3-amine.
Molecular Properties
| Compound Name | N,N-diethyl-5,6-dimethylpiperidin-3-amine |
| PubChem CID | 130560219 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N,N-diethyl-5,6-dimethylpiperidin-3-amine |
| SMILES | CCN(CC)C1CNC(C)C(C)C1 |
| InChI | InChI=1S/C11H24N2/c1-5-13(6-2)11-7-9(3)10(4)12-8-11/h9-12H,5-8H2,1-4H3 |
| InChIKey | VOAVLFUIDISSGZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethyl-5,6-dimethylpiperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-5,6-dimethylpiperidin-3-amine?
The IUPAC name of N,N-diethyl-5,6-dimethylpiperidin-3-amine (CID 130560219) is N,N-diethyl-5,6-dimethylpiperidin-3-amine.
What is the SMILES notation for N,N-diethyl-5,6-dimethylpiperidin-3-amine?
The canonical SMILES for N,N-diethyl-5,6-dimethylpiperidin-3-amine is CCN(CC)C1CNC(C)C(C)C1.
What is the InChIKey of N,N-diethyl-5,6-dimethylpiperidin-3-amine?
The InChIKey is VOAVLFUIDISSGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2/c1-5-13(6-2)11-7-9(3)10(4)12-8-11/h9-12H,5-8H2,1-4H3.
What are the key properties of N,N-diethyl-5,6-dimethylpiperidin-3-amine?
N,N-diethyl-5,6-dimethylpiperidin-3-amine has a molecular weight of 184.33 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-5,6-dimethylpiperidin-3-amine is sourced from PubChem (CID 130560219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).