C8H9F3N2S — CID 130565104
1-(4-methyl-1,3-thiazol-5-yl)-2-(trifluoromethyl)prop-2-en-1-amine (PubChem CID 130565104) has the molecular formula C8H9F3N2S and a molecular weight of 222.24 g/mol. Its IUPAC name is 1-(4-methyl-1,3-thiazol-5-yl)-2-(trifluoromethyl)prop-2-en-1-amine.
| Compound Name | 1-(4-methyl-1,3-thiazol-5-yl)-2-(trifluoromethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 130565104 |
| Molecular Formula | C8H9F3N2S |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 1-(4-methyl-1,3-thiazol-5-yl)-2-(trifluoromethyl)prop-2-en-1-amine |
| SMILES | C=C(C(N)c1scnc1C)C(F)(F)F |
| InChI | InChI=1S/C8H9F3N2S/c1-4(8(9,10)11)6(12)7-5(2)13-3-14-7/h3,6H,1,12H2,2H3 |
| InChIKey | HRXQBIFWQMKOHV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|