C17H9ClN4O3S2 — CID 1305662
[2-chloro-4-[(Z)-(5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] thiophene-2-carboxylate (PubChem CID 1305662) has the molecular formula C17H9ClN4O3S2 and a molecular weight of 416.87 g/mol. Its IUPAC name is [2-chloro-4-[(Z)-(5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [2-chloro-4-[(Z)-(5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1305662 |
| Molecular Formula | C17H9ClN4O3S2 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | [2-chloro-4-[(Z)-(5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] thiophene-2-carboxylate |
| SMILES | [H]/N=C1C(=C/c2ccc(OC(=O)c3cccs3)c(Cl)c2)/C(=O)N=C2SC=NN2/1 |
| InChI | InChI=1S/C17H9ClN4O3S2/c18-11-7-9(3-4-12(11)25-16(24)13-2-1-5-26-13)6-10-14(19)22-17(21-15(10)23)27-8-20-22/h1-8,19H/b10-6-,19-14- |
| InChIKey | BUNVQCQZODGHLV-IKEDHZNGSA-N |
| XLogP | 3.87 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|