C8H14O2 — CID 13058516
2-butyl-4-methyl-1,3-dioxole (PubChem CID 13058516) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-butyl-4-methyl-1,3-dioxole.
| Compound Name | 2-butyl-4-methyl-1,3-dioxole |
|---|---|
| PubChem CID | 13058516 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2-butyl-4-methyl-1,3-dioxole |
| SMILES | CCCCC1OC=C(C)O1 |
| InChI | InChI=1S/C8H14O2/c1-3-4-5-8-9-6-7(2)10-8/h6,8H,3-5H2,1-2H3 |
| InChIKey | JAUNJSGJNLPYAB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |