C8H12N6 — CID 130592078
1-(1H-imidazol-2-yl)-2-(2-methyltriazol-4-yl)ethanamine (PubChem CID 130592078) has the molecular formula C8H12N6 and a molecular weight of 192.23 g/mol. Its IUPAC name is 1-(1H-imidazol-2-yl)-2-(2-methyltriazol-4-yl)ethanamine.
| Compound Name | 1-(1H-imidazol-2-yl)-2-(2-methyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 130592078 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 1-(1H-imidazol-2-yl)-2-(2-methyltriazol-4-yl)ethanamine |
| SMILES | Cn1ncc(CC(N)c2ncc[nH]2)n1 |
| InChI | InChI=1S/C8H12N6/c1-14-12-5-6(13-14)4-7(9)8-10-2-3-11-8/h2-3,5,7H,4,9H2,1H3,(H,10,11) |
| InChIKey | QEZQXLJHCXIUSP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |