C10H16N2O2 — CID 130606195
prop-2-ynyl N-(4-aminocyclohexyl)carbamate (PubChem CID 130606195) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is prop-2-ynyl N-(4-aminocyclohexyl)carbamate.
| Compound Name | prop-2-ynyl N-(4-aminocyclohexyl)carbamate |
|---|---|
| PubChem CID | 130606195 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | prop-2-ynyl N-(4-aminocyclohexyl)carbamate |
| SMILES | C#CCOC(=O)NC1CCC(N)CC1 |
| InChI | InChI=1S/C10H16N2O2/c1-2-7-14-10(13)12-9-5-3-8(11)4-6-9/h1,8-9H,3-7,11H2,(H,12,13) |
| InChIKey | LMTWORWPYGUDFS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|