C8H5Br2N3O — CID 130626014
5,6-dibromo-N-(cyanomethyl)pyridine-3-carboxamide (PubChem CID 130626014) has the molecular formula C8H5Br2N3O and a molecular weight of 318.96 g/mol. Its IUPAC name is 5,6-dibromo-N-(cyanomethyl)pyridine-3-carboxamide.
| Compound Name | 5,6-dibromo-N-(cyanomethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 130626014 |
| Molecular Formula | C8H5Br2N3O |
| Molecular Weight | 318.96 g/mol |
| Exact Mass | 316.88 |
| IUPAC Name | 5,6-dibromo-N-(cyanomethyl)pyridine-3-carboxamide |
| SMILES | N#CCNC(=O)c1cnc(Br)c(Br)c1 |
| InChI | InChI=1S/C8H5Br2N3O/c9-6-3-5(4-13-7(6)10)8(14)12-2-1-11/h3-4H,2H2,(H,12,14) |
| InChIKey | LSCMAOPDSHLZNN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.96 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|