C10H8Br2N2O — CID 130665198
5,6-dibromo-N-but-2-ynylpyridine-3-carboxamide (PubChem CID 130665198) has the molecular formula C10H8Br2N2O and a molecular weight of 332.00 g/mol. Its IUPAC name is 5,6-dibromo-N-but-2-ynylpyridine-3-carboxamide.
| Compound Name | 5,6-dibromo-N-but-2-ynylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 130665198 |
| Molecular Formula | C10H8Br2N2O |
| Molecular Weight | 332.00 g/mol |
| Exact Mass | 329.90 |
| IUPAC Name | 5,6-dibromo-N-but-2-ynylpyridine-3-carboxamide |
| SMILES | CC#CCNC(=O)c1cnc(Br)c(Br)c1 |
| InChI | InChI=1S/C10H8Br2N2O/c1-2-3-4-13-10(15)7-5-8(11)9(12)14-6-7/h5-6H,4H2,1H3,(H,13,15) |
| InChIKey | SXEBPZKVRHTOIR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.00 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|