About 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile
4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile (PubChem CID 130641793) has the molecular formula C7H6F3N3
and a molecular weight of 189.14 g/mol. Its IUPAC name is 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile.
Molecular Properties
| Compound Name | 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile |
| PubChem CID | 130641793 |
| Molecular Formula | C7H6F3N3 |
| Molecular Weight | 189.14 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile |
| SMILES | N#Cc1cc([C@@H](N)C(F)(F)F)c[nH]1 |
| InChI | InChI=1S/C7H6F3N3/c8-7(9,10)6(12)4-1-5(2-11)13-3-4/h1,3,6,13H,12H2/t6-/m1/s1 |
| InChIKey | IQWUMSBBDWFSAE-ZCFIWIBFSA-N |
| XLogP | 1.45 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.14 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile?
The IUPAC name of 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile (CID 130641793) is 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile.
What is the SMILES notation for 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile?
The canonical SMILES for 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile is N#Cc1cc([C@@H](N)C(F)(F)F)c[nH]1.
What is the InChIKey of 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile?
The InChIKey is IQWUMSBBDWFSAE-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H6F3N3/c8-7(9,10)6(12)4-1-5(2-11)13-3-4/h1,3,6,13H,12H2/t6-/m1/s1.
What are the key properties of 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile?
4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile has a molecular weight of 189.14 g/mol, XLogP of 1.45, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R)-1-amino-2,2,2-trifluoroethyl]-1H-pyrrole-2-carbonitrile is sourced from PubChem (CID 130641793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).