C6H6BrF3N2 — CID 131096947
(1S)-1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trifluoroethanamine (PubChem CID 131096947) has the molecular formula C6H6BrF3N2 and a molecular weight of 243.03 g/mol. Its IUPAC name is (1S)-1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trifluoroethanamine.
| Compound Name | (1S)-1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 131096947 |
| Molecular Formula | C6H6BrF3N2 |
| Molecular Weight | 243.03 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | (1S)-1-(4-bromo-1H-pyrrol-2-yl)-2,2,2-trifluoroethanamine |
| SMILES | N[C@@H](c1cc(Br)c[nH]1)C(F)(F)F |
| InChI | InChI=1S/C6H6BrF3N2/c7-3-1-4(12-2-3)5(11)6(8,9)10/h1-2,5,12H,11H2/t5-/m0/s1 |
| InChIKey | DXLAXYCPWHCQCY-YFKPBYRVSA-N |
| XLogP | 2.34 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.03 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |