C7H11N3O2S — CID 130645718
1-[5-(methoxymethyl)-1,3-thiazol-2-yl]-3-methylurea (PubChem CID 130645718) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 1-[5-(methoxymethyl)-1,3-thiazol-2-yl]-3-methylurea.
| Compound Name | 1-[5-(methoxymethyl)-1,3-thiazol-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 130645718 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 1-[5-(methoxymethyl)-1,3-thiazol-2-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1ncc(COC)s1 |
| InChI | InChI=1S/C7H11N3O2S/c1-8-6(11)10-7-9-3-5(13-7)4-12-2/h3H,4H2,1-2H3,(H2,8,9,10,11) |
| InChIKey | FZOIJWFWKXCDLS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |