C6H6N4OS2 — CID 130009910
[2-(methylcarbamoylamino)-1,3-thiazol-5-yl] thiocyanate (PubChem CID 130009910) has the molecular formula C6H6N4OS2 and a molecular weight of 214.27 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-1,3-thiazol-5-yl] thiocyanate.
| Compound Name | [2-(methylcarbamoylamino)-1,3-thiazol-5-yl] thiocyanate |
|---|---|
| PubChem CID | 130009910 |
| Molecular Formula | C6H6N4OS2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | [2-(methylcarbamoylamino)-1,3-thiazol-5-yl] thiocyanate |
| SMILES | CNC(=O)Nc1ncc(SC#N)s1 |
| InChI | InChI=1S/C6H6N4OS2/c1-8-5(11)10-6-9-2-4(13-6)12-3-7/h2H,1H3,(H2,8,9,10,11) |
| InChIKey | HQPRDHAZDYMLHH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|