C17H23N3O5S2 — CID 143392593
2-[4-[dihydroxy(3-methoxypropyl)-λ4-sulfanyl]phenyl]-2-imino-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 143392593) has the molecular formula C17H23N3O5S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-[4-[dihydroxy(3-methoxypropyl)-λ4-sulfanyl]phenyl]-2-imino-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[4-[dihydroxy(3-methoxypropyl)-λ4-sulfanyl]phenyl]-2-imino-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 143392593 |
| Molecular Formula | C17H23N3O5S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 2-[4-[dihydroxy(3-methoxypropyl)-λ4-sulfanyl]phenyl]-2-imino-N-[5-(methoxymethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | [H]/N=C(\C(=O)Nc1ncc(COC)s1)c1ccc(S(O)(O)CCCOC)cc1 |
| InChI | InChI=1S/C17H23N3O5S2/c1-24-8-3-9-27(22,23)14-6-4-12(5-7-14)15(18)16(21)20-17-19-10-13(26-17)11-25-2/h4-7,10,18,22-23H,3,8-9,11H2,1-2H3,(H,19,20,21)/b18-15- |
| InChIKey | JZFBUANFTDZMFE-SDXDJHTJSA-N |
| XLogP | 3.44 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|