C8H9Cl2NO2S — CID 130649226
methyl (2S)-2-amino-2-(2,5-dichlorothiophen-3-yl)propanoate (PubChem CID 130649226) has the molecular formula C8H9Cl2NO2S and a molecular weight of 254.14 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-(2,5-dichlorothiophen-3-yl)propanoate.
| Compound Name | methyl (2S)-2-amino-2-(2,5-dichlorothiophen-3-yl)propanoate |
|---|---|
| PubChem CID | 130649226 |
| Molecular Formula | C8H9Cl2NO2S |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | methyl (2S)-2-amino-2-(2,5-dichlorothiophen-3-yl)propanoate |
| SMILES | COC(=O)[C@@](C)(N)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C8H9Cl2NO2S/c1-8(11,7(12)13-2)4-3-5(9)14-6(4)10/h3H,11H2,1-2H3/t8-/m0/s1 |
| InChIKey | NMWNHRGDADZZPB-QMMMGPOBSA-N |
| XLogP | 2.40 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |