About methyl 2-(2,5-dichlorothiophen-3-yl)-2,2-difluoroacetate
methyl 2-(2,5-dichlorothiophen-3-yl)-2,2-difluoroacetate (PubChem CID 168975344) has the molecular formula C7H4Cl2F2O2S
and a molecular weight of 261.08 g/mol. Its IUPAC name is methyl 2-(2,5-dichlorothiophen-3-yl)-2,2-difluoroacetate.
Analyze methyl 2-(2,5-dichlorothiophen-3-yl)-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,5-dichlorothiophen-3-yl)-2,2-difluoroacetate?
The IUPAC name of methyl 2-(2,5-dichlorothiophen-3-yl)-2,2-difluoroacetate (CID 168975344) is methyl 2-(2,5-dichlorothiophen-3-yl)-2,2-difluoroacetate.
What is the SMILES notation for methyl 2-(2,5-dichlorothiophen-3-yl)-2,2-difluoroacetate?
The canonical SMILES for methyl 2-(2,5-dichlorothiophen-3-yl)-2,2-difluoroacetate is COC(=O)C(F)(F)c1cc(Cl)sc1Cl.
What is the InChIKey of methyl 2-(2,5-dichlorothiophen-3-yl)-2,2-difluoroacetate?
The InChIKey is RFLXJFRWVABFBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2F2O2S/c1-13-6(12)7(10,11)3-2-4(8)14-5(3)9/h2H,1H3.
What are the key properties of methyl 2-(2,5-dichlorothiophen-3-yl)-2,2-difluoroacetate?
methyl 2-(2,5-dichlorothiophen-3-yl)-2,2-difluoroacetate has a molecular weight of 261.08 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,5-dichlorothiophen-3-yl)-2,2-difluoroacetate is sourced from PubChem (CID 168975344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).