C7H11N5O — CID 130652678
1-cyclopropyl-3-(2-methyl-1,2,4-triazol-3-yl)urea (PubChem CID 130652678) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2-methyl-1,2,4-triazol-3-yl)urea.
| Compound Name | 1-cyclopropyl-3-(2-methyl-1,2,4-triazol-3-yl)urea |
|---|---|
| PubChem CID | 130652678 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 1-cyclopropyl-3-(2-methyl-1,2,4-triazol-3-yl)urea |
| SMILES | Cn1ncnc1NC(=O)NC1CC1 |
| InChI | InChI=1S/C7H11N5O/c1-12-6(8-4-9-12)11-7(13)10-5-2-3-5/h4-5H,2-3H2,1H3,(H2,8,9,10,11,13) |
| InChIKey | QKQVYMUHRUHQPP-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |