C11H15NO2 — CID 130673894
2-[[(3S)-3-amino-2,3-dihydro-1H-inden-4-yl]oxy]ethanol (PubChem CID 130673894) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-[[(3S)-3-amino-2,3-dihydro-1H-inden-4-yl]oxy]ethanol.
| Compound Name | 2-[[(3S)-3-amino-2,3-dihydro-1H-inden-4-yl]oxy]ethanol |
|---|---|
| PubChem CID | 130673894 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-[[(3S)-3-amino-2,3-dihydro-1H-inden-4-yl]oxy]ethanol |
| SMILES | N[C@H]1CCc2cccc(OCCO)c21 |
| InChI | InChI=1S/C11H15NO2/c12-9-5-4-8-2-1-3-10(11(8)9)14-7-6-13/h1-3,9,13H,4-7,12H2/t9-/m0/s1 |
| InChIKey | RVRUESVYOUIQRZ-VIFPVBQESA-N |
| XLogP | 1.00 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |