C9H17N3S — CID 130678657
4-(2,3,3-trimethylbutan-2-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 130678657) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is 4-(2,3,3-trimethylbutan-2-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2,3,3-trimethylbutan-2-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 130678657 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-(2,3,3-trimethylbutan-2-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)(C)C(C)(C)n1cn[nH]c1=S |
| InChI | InChI=1S/C9H17N3S/c1-8(2,3)9(4,5)12-6-10-11-7(12)13/h6H,1-5H3,(H,11,13) |
| InChIKey | PQQBABPPKPBESG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|