C2H6N6S — CID 126674088
4-(diaminoamino)-1H-1,2,4-triazole-5-thione (PubChem CID 126674088) has the molecular formula C2H6N6S and a molecular weight of 146.18 g/mol. Its IUPAC name is 4-(diaminoamino)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(diaminoamino)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 126674088 |
| Molecular Formula | C2H6N6S |
| Molecular Weight | 146.18 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 4-(diaminoamino)-1H-1,2,4-triazole-5-thione |
| SMILES | NN(N)n1cn[nH]c1=S |
| InChI | InChI=1S/C2H6N6S/c3-8(4)7-1-5-6-2(7)9/h1H,3-4H2,(H,6,9) |
| InChIKey | XTLIVBPQAILSTC-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.18 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|