C18H14N2S — CID 13067869
(3R,4R)-2,2-diphenylthiolane-3,4-dicarbonitrile (PubChem CID 13067869) has the molecular formula C18H14N2S and a molecular weight of 290.39 g/mol. Its IUPAC name is (3R,4R)-2,2-diphenylthiolane-3,4-dicarbonitrile.
| Compound Name | (3R,4R)-2,2-diphenylthiolane-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 13067869 |
| Molecular Formula | C18H14N2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (3R,4R)-2,2-diphenylthiolane-3,4-dicarbonitrile |
| SMILES | N#C[C@@H]1CSC(c2ccccc2)(c2ccccc2)[C@H]1C#N |
| InChI | InChI=1S/C18H14N2S/c19-11-14-13-21-18(17(14)12-20,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,14,17H,13H2/t14-,17+/m1/s1 |
| InChIKey | RFKLLXUFUKJMJA-PBHICJAKSA-N |
| XLogP | 3.96 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |