C24H19F3OS — CID 139088698
[(3R,4R)-2,2-diphenyl-4-(trifluoromethyl)thiolan-3-yl]-phenylmethanone (PubChem CID 139088698) has the molecular formula C24H19F3OS and a molecular weight of 412.48 g/mol. Its IUPAC name is [(3R,4R)-2,2-diphenyl-4-(trifluoromethyl)thiolan-3-yl]-phenylmethanone.
| Compound Name | [(3R,4R)-2,2-diphenyl-4-(trifluoromethyl)thiolan-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 139088698 |
| Molecular Formula | C24H19F3OS |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [(3R,4R)-2,2-diphenyl-4-(trifluoromethyl)thiolan-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@H]1[C@H](C(F)(F)F)CSC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H19F3OS/c25-24(26,27)20-16-29-23(18-12-6-2-7-13-18,19-14-8-3-9-15-19)21(20)22(28)17-10-4-1-5-11-17/h1-15,20-21H,16H2/t20-,21-/m1/s1 |
| InChIKey | PDVFYSSTQMIXQG-NHCUHLMSSA-N |
| XLogP | 6.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |