C13H13AsN3 — CID 136675857
CID 136675857 (PubChem CID 136675857) has the molecular formula C13H13AsN3 and a molecular weight of 286.19 g/mol.
| Compound Name | CID 136675857 |
|---|---|
| PubChem CID | 136675857 |
| Molecular Formula | C13H13AsN3 |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | — |
| SMILES | CN(C)[C@]1(c2ccccc2)[As][C@H](C#N)[C@H]1C#N |
| InChI | InChI=1S/C13H13AsN3/c1-17(2)13(10-6-4-3-5-7-10)11(8-15)12(9-16)14-13/h3-7,11-12H,1-2H3/t11-,12-,13+/m1/s1 |
| InChIKey | WWSDLUJANYCZDH-UPJWGTAASA-N |
| XLogP | 1.57 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|