About 2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide
2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide (PubChem CID 130686025) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide.
Molecular Properties
| Compound Name | 2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide |
| PubChem CID | 130686025 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide |
| SMILES | CN(C)CC(=O)NC1CC1(C)C |
| InChI | InChI=1S/C9H18N2O/c1-9(2)5-7(9)10-8(12)6-11(3)4/h7H,5-6H2,1-4H3,(H,10,12) |
| InChIKey | YUEUENAZHIOMEZ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide?
The IUPAC name of 2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide (CID 130686025) is 2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide.
What is the SMILES notation for 2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide?
The canonical SMILES for 2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide is CN(C)CC(=O)NC1CC1(C)C.
What is the InChIKey of 2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide?
The InChIKey is YUEUENAZHIOMEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-9(2)5-7(9)10-8(12)6-11(3)4/h7H,5-6H2,1-4H3,(H,10,12).
What are the key properties of 2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide?
2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide has a molecular weight of 170.26 g/mol, XLogP of 0.46, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-N-(2,2-dimethylcyclopropyl)acetamide is sourced from PubChem (CID 130686025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).