C6H10N2OS — CID 130690765
2-amino-1-(3-methyl-1,2-thiazol-5-yl)ethanol (PubChem CID 130690765) has the molecular formula C6H10N2OS and a molecular weight of 158.23 g/mol. Its IUPAC name is 2-amino-1-(3-methyl-1,2-thiazol-5-yl)ethanol.
| Compound Name | 2-amino-1-(3-methyl-1,2-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 130690765 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 2-amino-1-(3-methyl-1,2-thiazol-5-yl)ethanol |
| SMILES | Cc1cc(C(O)CN)sn1 |
| InChI | InChI=1S/C6H10N2OS/c1-4-2-6(10-8-4)5(9)3-7/h2,5,9H,3,7H2,1H3 |
| InChIKey | NJRZUFAEBODMKH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |