About 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine
1-(3-fluoropropyl)-2,2,4-trimethylpiperazine (PubChem CID 130693360) has the molecular formula C10H21FN2
and a molecular weight of 188.29 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine.
Molecular Properties
| Compound Name | 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine |
| PubChem CID | 130693360 |
| Molecular Formula | C10H21FN2 |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.17 |
| IUPAC Name | 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine |
| SMILES | CN1CCN(CCCF)C(C)(C)C1 |
| InChI | InChI=1S/C10H21FN2/c1-10(2)9-12(3)7-8-13(10)6-4-5-11/h4-9H2,1-3H3 |
| InChIKey | OSFDMVHHFWZZGC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine?
The IUPAC name of 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine (CID 130693360) is 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine.
What is the SMILES notation for 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine?
The canonical SMILES for 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine is CN1CCN(CCCF)C(C)(C)C1.
What is the InChIKey of 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine?
The InChIKey is OSFDMVHHFWZZGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21FN2/c1-10(2)9-12(3)7-8-13(10)6-4-5-11/h4-9H2,1-3H3.
What are the key properties of 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine?
1-(3-fluoropropyl)-2,2,4-trimethylpiperazine has a molecular weight of 188.29 g/mol, XLogP of 1.37, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine is sourced from PubChem (CID 130693360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).