C10H21FN2 — CID 130693360
1-(3-fluoropropyl)-2,2,4-trimethylpiperazine (PubChem CID 130693360) has the molecular formula C10H21FN2 and a molecular weight of 188.29 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine.
| Compound Name | 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine |
|---|---|
| PubChem CID | 130693360 |
| Molecular Formula | C10H21FN2 |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.17 |
| IUPAC Name | 1-(3-fluoropropyl)-2,2,4-trimethylpiperazine |
| SMILES | CN1CCN(CCCF)C(C)(C)C1 |
| InChI | InChI=1S/C10H21FN2/c1-10(2)9-12(3)7-8-13(10)6-4-5-11/h4-9H2,1-3H3 |
| InChIKey | OSFDMVHHFWZZGC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |