C7H10Cl2NO4P — CID 13071028
1,1-dichloro-2-diethoxyphosphoryl-2-isocyanatoethene (PubChem CID 13071028) has the molecular formula C7H10Cl2NO4P and a molecular weight of 274.04 g/mol. Its IUPAC name is 1,1-dichloro-2-diethoxyphosphoryl-2-isocyanatoethene.
| Compound Name | 1,1-dichloro-2-diethoxyphosphoryl-2-isocyanatoethene |
|---|---|
| PubChem CID | 13071028 |
| Molecular Formula | C7H10Cl2NO4P |
| Molecular Weight | 274.04 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | 1,1-dichloro-2-diethoxyphosphoryl-2-isocyanatoethene |
| SMILES | CCOP(=O)(OCC)C(N=C=O)=C(Cl)Cl |
| InChI | InChI=1S/C7H10Cl2NO4P/c1-3-13-15(12,14-4-2)7(6(8)9)10-5-11/h3-4H2,1-2H3 |
| InChIKey | SXNARFFQDPHCPK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.04 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|