C8H10Cl2F2NO3P — CID 23421980
(E)-3,4-dichloro-2-diethoxyphosphoryl-4,4-difluorobut-2-enenitrile (PubChem CID 23421980) has the molecular formula C8H10Cl2F2NO3P and a molecular weight of 308.05 g/mol. Its IUPAC name is (E)-3,4-dichloro-2-diethoxyphosphoryl-4,4-difluorobut-2-enenitrile.
| Compound Name | (E)-3,4-dichloro-2-diethoxyphosphoryl-4,4-difluorobut-2-enenitrile |
|---|---|
| PubChem CID | 23421980 |
| Molecular Formula | C8H10Cl2F2NO3P |
| Molecular Weight | 308.05 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | (E)-3,4-dichloro-2-diethoxyphosphoryl-4,4-difluorobut-2-enenitrile |
| SMILES | CCOP(=O)(OCC)/C(C#N)=C(/Cl)C(F)(F)Cl |
| InChI | InChI=1S/C8H10Cl2F2NO3P/c1-3-15-17(14,16-4-2)6(5-13)7(9)8(10,11)12/h3-4H2,1-2H3/b7-6+ |
| InChIKey | ODTOFURHCDNVON-VOTSOKGWSA-N |
| XLogP | 4.06 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.05 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|