C20H20BrCl3O3 — CID 13071294
2-[2-bromo-1-(4-chlorophenyl)ethoxy]-6-[(2,4-dichlorophenoxy)methyl]oxane (PubChem CID 13071294) has the molecular formula C20H20BrCl3O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is 2-[2-bromo-1-(4-chlorophenyl)ethoxy]-6-[(2,4-dichlorophenoxy)methyl]oxane.
| Compound Name | 2-[2-bromo-1-(4-chlorophenyl)ethoxy]-6-[(2,4-dichlorophenoxy)methyl]oxane |
|---|---|
| PubChem CID | 13071294 |
| Molecular Formula | C20H20BrCl3O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 491.97 |
| IUPAC Name | 2-[2-bromo-1-(4-chlorophenyl)ethoxy]-6-[(2,4-dichlorophenoxy)methyl]oxane |
| SMILES | Clc1ccc(C(CBr)OC2CCCC(COc3ccc(Cl)cc3Cl)O2)cc1 |
| InChI | InChI=1S/C20H20BrCl3O3/c21-11-19(13-4-6-14(22)7-5-13)27-20-3-1-2-16(26-20)12-25-18-9-8-15(23)10-17(18)24/h4-10,16,19-20H,1-3,11-12H2 |
| InChIKey | CFHCHXMECIRAQJ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|