C21H22BrCl3O3 — CID 70546614
1-[6-[2-bromo-1-(2,4-dichlorophenyl)ethoxy]oxan-2-yl]-2-(4-chlorophenyl)ethanol (PubChem CID 70546614) has the molecular formula C21H22BrCl3O3 and a molecular weight of 508.67 g/mol. Its IUPAC name is 1-[6-[2-bromo-1-(2,4-dichlorophenyl)ethoxy]oxan-2-yl]-2-(4-chlorophenyl)ethanol.
| Compound Name | 1-[6-[2-bromo-1-(2,4-dichlorophenyl)ethoxy]oxan-2-yl]-2-(4-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 70546614 |
| Molecular Formula | C21H22BrCl3O3 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 505.98 |
| IUPAC Name | 1-[6-[2-bromo-1-(2,4-dichlorophenyl)ethoxy]oxan-2-yl]-2-(4-chlorophenyl)ethanol |
| SMILES | OC(Cc1ccc(Cl)cc1)C1CCCC(OC(CBr)c2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C21H22BrCl3O3/c22-12-20(16-9-8-15(24)11-17(16)25)28-21-3-1-2-19(27-21)18(26)10-13-4-6-14(23)7-5-13/h4-9,11,18-21,26H,1-3,10,12H2 |
| InChIKey | CPOXATNRJUXQNU-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|