C17H20Cl2N2O2 — CID 70546669
2-[[(2R,6S)-6-[1-(2,4-dichlorophenyl)ethoxy]oxan-2-yl]methyl]-1H-imidazole (PubChem CID 70546669) has the molecular formula C17H20Cl2N2O2 and a molecular weight of 355.27 g/mol. Its IUPAC name is 2-[[(2R,6S)-6-[1-(2,4-dichlorophenyl)ethoxy]oxan-2-yl]methyl]-1H-imidazole.
| Compound Name | 2-[[(2R,6S)-6-[1-(2,4-dichlorophenyl)ethoxy]oxan-2-yl]methyl]-1H-imidazole |
|---|---|
| PubChem CID | 70546669 |
| Molecular Formula | C17H20Cl2N2O2 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-[[(2R,6S)-6-[1-(2,4-dichlorophenyl)ethoxy]oxan-2-yl]methyl]-1H-imidazole |
| SMILES | CC(O[C@H]1CCC[C@H](Cc2ncc[nH]2)O1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H20Cl2N2O2/c1-11(14-6-5-12(18)9-15(14)19)22-17-4-2-3-13(23-17)10-16-20-7-8-21-16/h5-9,11,13,17H,2-4,10H2,1H3,(H,20,21)/t11?,13-,17-/m1/s1 |
| InChIKey | YUYCUMPRYMWMBI-STQVRIHGSA-N |
| XLogP | 4.93 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |