C8H11ClN4O — CID 130719253
2-[(6-amino-5-chloropyrimidin-4-yl)amino]but-3-en-1-ol (PubChem CID 130719253) has the molecular formula C8H11ClN4O and a molecular weight of 214.66 g/mol. Its IUPAC name is 2-[(6-amino-5-chloropyrimidin-4-yl)amino]but-3-en-1-ol.
| Compound Name | 2-[(6-amino-5-chloropyrimidin-4-yl)amino]but-3-en-1-ol |
|---|---|
| PubChem CID | 130719253 |
| Molecular Formula | C8H11ClN4O |
| Molecular Weight | 214.66 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-[(6-amino-5-chloropyrimidin-4-yl)amino]but-3-en-1-ol |
| SMILES | C=CC(CO)Nc1ncnc(N)c1Cl |
| InChI | InChI=1S/C8H11ClN4O/c1-2-5(3-14)13-8-6(9)7(10)11-4-12-8/h2,4-5,14H,1,3H2,(H3,10,11,12,13) |
| InChIKey | RCGPXOSCIVRFKD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.66 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|