C9H12N2O2 — CID 130723793
N-(2-cyanoethyl)-3,4-dihydro-2H-pyran-2-carboxamide (PubChem CID 130723793) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3,4-dihydro-2H-pyran-2-carboxamide.
| Compound Name | N-(2-cyanoethyl)-3,4-dihydro-2H-pyran-2-carboxamide |
|---|---|
| PubChem CID | 130723793 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | N-(2-cyanoethyl)-3,4-dihydro-2H-pyran-2-carboxamide |
| SMILES | N#CCCNC(=O)C1CCC=CO1 |
| InChI | InChI=1S/C9H12N2O2/c10-5-3-6-11-9(12)8-4-1-2-7-13-8/h2,7-8H,1,3-4,6H2,(H,11,12) |
| InChIKey | ZQYXOPDGBWRWBC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|