C6H8N4O2S — CID 130727688
6-methyl-2-(nitromethylsulfanyl)pyrimidin-4-amine (PubChem CID 130727688) has the molecular formula C6H8N4O2S and a molecular weight of 200.22 g/mol. Its IUPAC name is 6-methyl-2-(nitromethylsulfanyl)pyrimidin-4-amine.
| Compound Name | 6-methyl-2-(nitromethylsulfanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 130727688 |
| Molecular Formula | C6H8N4O2S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 6-methyl-2-(nitromethylsulfanyl)pyrimidin-4-amine |
| SMILES | Cc1cc(N)nc(SC[N+](=O)[O-])n1 |
| InChI | InChI=1S/C6H8N4O2S/c1-4-2-5(7)9-6(8-4)13-3-10(11)12/h2H,3H2,1H3,(H2,7,8,9) |
| InChIKey | PICBOVMOGXMXEP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|