C11H19NO2 — CID 130760663
(1R,3R,4R,5R,7R,8R)-2-ethyl-2-azatricyclo[3.3.1.13,7]decane-4,8-diol (PubChem CID 130760663) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (1R,3R,4R,5R,7R,8R)-2-ethyl-2-azatricyclo[3.3.1.13,7]decane-4,8-diol.
| Compound Name | (1R,3R,4R,5R,7R,8R)-2-ethyl-2-azatricyclo[3.3.1.13,7]decane-4,8-diol |
|---|---|
| PubChem CID | 130760663 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (1R,3R,4R,5R,7R,8R)-2-ethyl-2-azatricyclo[3.3.1.13,7]decane-4,8-diol |
| SMILES | CCN1[C@@H]2C[C@H]3C[C@H](C[C@@H]1[C@@H]3O)[C@H]2O |
| InChI | InChI=1S/C11H19NO2/c1-2-12-8-4-6-3-7(11(8)14)5-9(12)10(6)13/h6-11,13-14H,2-5H2,1H3/t6-,7-,8-,9-,10-,11-/m1/s1 |
| InChIKey | STXHKOBXWXLMQW-VRGHXPGPSA-N |
| XLogP | 0.21 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |